C17H17NO5S2 — CID 3753643
2-[3-ethoxy-4-(thiophene-2-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 3753643) has the molecular formula C17H17NO5S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[3-ethoxy-4-(thiophene-2-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-[3-ethoxy-4-(thiophene-2-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3753643 |
| Molecular Formula | C17H17NO5S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 2-[3-ethoxy-4-(thiophene-2-carbonyloxy)phenyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCOc1cc(C2NC(C(=O)O)CS2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C17H17NO5S2/c1-2-22-13-8-10(15-18-11(9-25-15)16(19)20)5-6-12(13)23-17(21)14-4-3-7-24-14/h3-8,11,15,18H,2,9H2,1H3,(H,19,20) |
| InChIKey | JIHHGXRPBUHILB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|