C7H11NO4S — CID 28775163
dimethyl (2S,4S)-1,3-thiazolidine-2,4-dicarboxylate (PubChem CID 28775163) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is dimethyl (2S,4S)-1,3-thiazolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2S,4S)-1,3-thiazolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 28775163 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | dimethyl (2S,4S)-1,3-thiazolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1CS[C@@H](C(=O)OC)N1 |
| InChI | InChI=1S/C7H11NO4S/c1-11-6(9)4-3-13-5(8-4)7(10)12-2/h4-5,8H,3H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | ZZAHPKXSIYXTAP-UHNVWZDZSA-N |
| XLogP | -0.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |