methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate

C9H17NO2S — CID 101131848

IUPACmethyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate
SMILESCOC(=O)[C@@H]1CS[C@H](CC(C)C)N1
InChIInChI=1S/C9H17NO2S/c1-6(2)4-8-10-7(5-13-8)9(11)12-3/h6-8,10H,4-5H2,1-3H3/t7-,8+/m0/s1
InChIKeySPQFBRDNUJFFOA-JGVFFNPUSA-N
MW203.31 g/mol
LogP1.24
Rot. Bonds3

About methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate

methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 101131848) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate.

Molecular Properties

Compound Namemethyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate
PubChem CID101131848
Molecular FormulaC9H17NO2S
Molecular Weight203.31 g/mol
Exact Mass203.10
IUPAC Namemethyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate
SMILESCOC(=O)[C@@H]1CS[C@H](CC(C)C)N1
InChIInChI=1S/C9H17NO2S/c1-6(2)4-8-10-7(5-13-8)9(11)12-3/h6-8,10H,4-5H2,1-3H3/t7-,8+/m0/s1
InChIKeySPQFBRDNUJFFOA-JGVFFNPUSA-N
XLogP1.24
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.31
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate?
The IUPAC name of methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate (CID 101131848) is methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate is COC(=O)[C@@H]1CS[C@H](CC(C)C)N1.
What is the InChIKey of methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate?
The InChIKey is SPQFBRDNUJFFOA-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-6(2)4-8-10-7(5-13-8)9(11)12-3/h6-8,10H,4-5H2,1-3H3/t7-,8+/m0/s1.
What are the key properties of methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate?
methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate has a molecular weight of 203.31 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,4R)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 101131848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).