C11H22Cl2N3O4PS — CID 67930223
methyl 2-[2-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxyethyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 67930223) has the molecular formula C11H22Cl2N3O4PS and a molecular weight of 394.26 g/mol. Its IUPAC name is methyl 2-[2-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxyethyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 2-[2-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxyethyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 67930223 |
| Molecular Formula | C11H22Cl2N3O4PS |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | methyl 2-[2-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxyethyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CSC(CCOP(N)(=O)N(CCCl)CCCl)N1 |
| InChI | InChI=1S/C11H22Cl2N3O4PS/c1-19-11(17)9-8-22-10(15-9)2-7-20-21(14,18)16(5-3-12)6-4-13/h9-10,15H,2-8H2,1H3,(H2,14,18) |
| InChIKey | LODQYBTYYMPCJM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|