C11H21NO2S — CID 42744271
propyl 2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 42744271) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is propyl 2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | propyl 2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42744271 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | propyl 2-(2-methylpropyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCOC(=O)C1CSC(CC(C)C)N1 |
| InChI | InChI=1S/C11H21NO2S/c1-4-5-14-11(13)9-7-15-10(12-9)6-8(2)3/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | ONBMGTIGQKAGBT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |