C9H19NS — CID 66230749
4-ethyl-2-(2-methylpropyl)-1,3-thiazolidine (PubChem CID 66230749) has the molecular formula C9H19NS and a molecular weight of 173.32 g/mol. Its IUPAC name is 4-ethyl-2-(2-methylpropyl)-1,3-thiazolidine.
| Compound Name | 4-ethyl-2-(2-methylpropyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 66230749 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4-ethyl-2-(2-methylpropyl)-1,3-thiazolidine |
| SMILES | CCC1CSC(CC(C)C)N1 |
| InChI | InChI=1S/C9H19NS/c1-4-8-6-11-9(10-8)5-7(2)3/h7-10H,4-6H2,1-3H3 |
| InChIKey | GZAMUSCKFMAGFS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |