C8H17NS — CID 66218897
4-methyl-2-(2-methylpropyl)-1,3-thiazolidine (PubChem CID 66218897) has the molecular formula C8H17NS and a molecular weight of 159.30 g/mol. Its IUPAC name is 4-methyl-2-(2-methylpropyl)-1,3-thiazolidine.
| Compound Name | 4-methyl-2-(2-methylpropyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 66218897 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 4-methyl-2-(2-methylpropyl)-1,3-thiazolidine |
| SMILES | CC(C)CC1NC(C)CS1 |
| InChI | InChI=1S/C8H17NS/c1-6(2)4-8-9-7(3)5-10-8/h6-9H,4-5H2,1-3H3 |
| InChIKey | PDRANCLHCBCWRG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |