C9H19NS — CID 66219394
4-methyl-2-pentyl-1,3-thiazolidine (PubChem CID 66219394) has the molecular formula C9H19NS and a molecular weight of 173.32 g/mol. Its IUPAC name is 4-methyl-2-pentyl-1,3-thiazolidine.
| Compound Name | 4-methyl-2-pentyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 66219394 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4-methyl-2-pentyl-1,3-thiazolidine |
| SMILES | CCCCCC1NC(C)CS1 |
| InChI | InChI=1S/C9H19NS/c1-3-4-5-6-9-10-8(2)7-11-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | AARDVPMUXRADCM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|