C11H23NS — CID 66232199
2-hexyl-4-methyl-1,3-thiazinane (PubChem CID 66232199) has the molecular formula C11H23NS and a molecular weight of 201.38 g/mol. Its IUPAC name is 2-hexyl-4-methyl-1,3-thiazinane.
| Compound Name | 2-hexyl-4-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 66232199 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 2-hexyl-4-methyl-1,3-thiazinane |
| SMILES | CCCCCCC1NC(C)CCS1 |
| InChI | InChI=1S/C11H23NS/c1-3-4-5-6-7-11-12-10(2)8-9-13-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | MMFRTLJATFRFSL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|