C11H21NO2S — CID 97292543
(2R,4R)-2-heptyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 97292543) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is (2R,4R)-2-heptyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-2-heptyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 97292543 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2R,4R)-2-heptyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCCCC[C@@H]1N[C@H](C(=O)O)CS1 |
| InChI | InChI=1S/C11H21NO2S/c1-2-3-4-5-6-7-10-12-9(8-15-10)11(13)14/h9-10,12H,2-8H2,1H3,(H,13,14)/t9-,10+/m0/s1 |
| InChIKey | PBFKOPWETDLXRE-VHSXEESVSA-N |
| XLogP | 2.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|