C13H27NS2 — CID 528748
4-butyl-2-methyl-6-pentyl-1,3,5-dithiazinane (PubChem CID 528748) has the molecular formula C13H27NS2 and a molecular weight of 261.50 g/mol. Its IUPAC name is 4-butyl-2-methyl-6-pentyl-1,3,5-dithiazinane.
| Compound Name | 4-butyl-2-methyl-6-pentyl-1,3,5-dithiazinane |
|---|---|
| PubChem CID | 528748 |
| Molecular Formula | C13H27NS2 |
| Molecular Weight | 261.50 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 4-butyl-2-methyl-6-pentyl-1,3,5-dithiazinane |
| SMILES | CCCCCC1NC(CCCC)SC(C)S1 |
| InChI | InChI=1S/C13H27NS2/c1-4-6-8-10-13-14-12(9-7-5-2)15-11(3)16-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | YSHOAYUYWBSGHO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|