C20H40S2 — CID 20721731
2,3,5,6-tetrabutyl-1,4-dithiane (PubChem CID 20721731) has the molecular formula C20H40S2 and a molecular weight of 344.67 g/mol. Its IUPAC name is 2,3,5,6-tetrabutyl-1,4-dithiane.
| Compound Name | 2,3,5,6-tetrabutyl-1,4-dithiane |
|---|---|
| PubChem CID | 20721731 |
| Molecular Formula | C20H40S2 |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 2,3,5,6-tetrabutyl-1,4-dithiane |
| SMILES | CCCCC1SC(CCCC)C(CCCC)SC1CCCC |
| InChI | InChI=1S/C20H40S2/c1-5-9-13-17-18(14-10-6-2)22-20(16-12-8-4)19(21-17)15-11-7-3/h17-20H,5-16H2,1-4H3 |
| InChIKey | GUOHJGZWHHSERI-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |