C9H16S2 — CID 101170868
(4R,5S)-5-butyl-4-methylthiolane-2-thione (PubChem CID 101170868) has the molecular formula C9H16S2 and a molecular weight of 188.36 g/mol. Its IUPAC name is (4R,5S)-5-butyl-4-methylthiolane-2-thione.
| Compound Name | (4R,5S)-5-butyl-4-methylthiolane-2-thione |
|---|---|
| PubChem CID | 101170868 |
| Molecular Formula | C9H16S2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (4R,5S)-5-butyl-4-methylthiolane-2-thione |
| SMILES | CCCC[C@@H]1SC(=S)C[C@H]1C |
| InChI | InChI=1S/C9H16S2/c1-3-4-5-8-7(2)6-9(10)11-8/h7-8H,3-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | KRJXCMCPWNDYTN-SFYZADRCSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|