C12H24O2 — CID 123314380
6-butyl-3-methylcycloheptane-1,2-diol (PubChem CID 123314380) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 6-butyl-3-methylcycloheptane-1,2-diol.
| Compound Name | 6-butyl-3-methylcycloheptane-1,2-diol |
|---|---|
| PubChem CID | 123314380 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 6-butyl-3-methylcycloheptane-1,2-diol |
| SMILES | CCCCC1CCC(C)C(O)C(O)C1 |
| InChI | InChI=1S/C12H24O2/c1-3-4-5-10-7-6-9(2)12(14)11(13)8-10/h9-14H,3-8H2,1-2H3 |
| InChIKey | KKOAJDGZTWIVQY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |