C12H22Na2O4 — CID 175118438
disodium;4-butylcyclohexane-1,2-dicarboxylic acid;hydride (PubChem CID 175118438) has the molecular formula C12H22Na2O4 and a molecular weight of 276.28 g/mol. Its IUPAC name is disodium;4-butylcyclohexane-1,2-dicarboxylic acid;hydride.
| Compound Name | disodium;4-butylcyclohexane-1,2-dicarboxylic acid;hydride |
|---|---|
| PubChem CID | 175118438 |
| Molecular Formula | C12H22Na2O4 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | disodium;4-butylcyclohexane-1,2-dicarboxylic acid;hydride |
| SMILES | CCCCC1CCC(C(=O)O)C(C(=O)O)C1.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C12H20O4.2Na.2H/c1-2-3-4-8-5-6-9(11(13)14)10(7-8)12(15)16;;;;/h8-10H,2-7H2,1H3,(H,13,14)(H,15,16);;;;/q;2*+1;2*-1 |
| InChIKey | DGLCDHHEMUAHRE-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |