C14H24 — CID 90992302
3,6-dibutylcyclohexa-1,4-diene (PubChem CID 90992302) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 3,6-dibutylcyclohexa-1,4-diene.
| Compound Name | 3,6-dibutylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 90992302 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 3,6-dibutylcyclohexa-1,4-diene |
| SMILES | CCCCC1C=CC(CCCC)C=C1 |
| InChI | InChI=1S/C14H24/c1-3-5-7-13-9-11-14(12-10-13)8-6-4-2/h9-14H,3-8H2,1-2H3 |
| InChIKey | MXIUOSGPFKURGQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|