C13H20 — CID 142802346
3-methyl-7-pentylcyclohepta-1,3,5-triene (PubChem CID 142802346) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 3-methyl-7-pentylcyclohepta-1,3,5-triene.
| Compound Name | 3-methyl-7-pentylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142802346 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 3-methyl-7-pentylcyclohepta-1,3,5-triene |
| SMILES | CCCCCC1C=CC=C(C)C=C1 |
| InChI | InChI=1S/C13H20/c1-3-4-5-8-13-9-6-7-12(2)10-11-13/h6-7,9-11,13H,3-5,8H2,1-2H3 |
| InChIKey | QTALNIVIXHDRKK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|