C15H22 — CID 123846771
1-hexyl-4-methylcycloocta-1,3,5,7-tetraene (PubChem CID 123846771) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-hexyl-4-methylcycloocta-1,3,5,7-tetraene.
| Compound Name | 1-hexyl-4-methylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 123846771 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-hexyl-4-methylcycloocta-1,3,5,7-tetraene |
| SMILES | CCCCCCC1=CC=C(C)C=CC=C1 |
| InChI | InChI=1S/C15H22/c1-3-4-5-6-10-15-11-8-7-9-14(2)12-13-15/h7-9,11-13H,3-6,10H2,1-2H3 |
| InChIKey | OCIPZQRYPKCRNF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|