C19H32O — CID 151136943
2-decyl-3,4,5-trimethylphenol (PubChem CID 151136943) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 2-decyl-3,4,5-trimethylphenol.
| Compound Name | 2-decyl-3,4,5-trimethylphenol |
|---|---|
| PubChem CID | 151136943 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 2-decyl-3,4,5-trimethylphenol |
| SMILES | CCCCCCCCCCc1c(O)cc(C)c(C)c1C |
| InChI | InChI=1S/C19H32O/c1-5-6-7-8-9-10-11-12-13-18-17(4)16(3)15(2)14-19(18)20/h14,20H,5-13H2,1-4H3 |
| InChIKey | MVJWNTGFOBYNPU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|