C15H24O2 — CID 54410665
2-hexyl-3,5,6-trimethylbenzene-1,4-diol (PubChem CID 54410665) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-hexyl-3,5,6-trimethylbenzene-1,4-diol.
| Compound Name | 2-hexyl-3,5,6-trimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 54410665 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-hexyl-3,5,6-trimethylbenzene-1,4-diol |
| SMILES | CCCCCCc1c(C)c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C15H24O2/c1-5-6-7-8-9-13-12(4)14(16)10(2)11(3)15(13)17/h16-17H,5-9H2,1-4H3 |
| InChIKey | VTWUYWVCIJXCTO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|