C14H20Cl2O2 — CID 23042493
2,5-dichloro-3-octylbenzene-1,4-diol (PubChem CID 23042493) has the molecular formula C14H20Cl2O2 and a molecular weight of 291.22 g/mol. Its IUPAC name is 2,5-dichloro-3-octylbenzene-1,4-diol.
| Compound Name | 2,5-dichloro-3-octylbenzene-1,4-diol |
|---|---|
| PubChem CID | 23042493 |
| Molecular Formula | C14H20Cl2O2 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2,5-dichloro-3-octylbenzene-1,4-diol |
| SMILES | CCCCCCCCc1c(O)c(Cl)cc(O)c1Cl |
| InChI | InChI=1S/C14H20Cl2O2/c1-2-3-4-5-6-7-8-10-13(16)12(17)9-11(15)14(10)18/h9,17-18H,2-8H2,1H3 |
| InChIKey | KTFMKNQEHBDBIQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|