C48H64O8 — CID 2724953
25,26,27,28-tetrapentylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol (PubChem CID 2724953) has the molecular formula C48H64O8 and a molecular weight of 769.03 g/mol. Its IUPAC name is 25,26,27,28-tetrapentylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol.
| Compound Name | 25,26,27,28-tetrapentylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol |
|---|---|
| PubChem CID | 2724953 |
| Molecular Formula | C48H64O8 |
| Molecular Weight | 769.03 g/mol |
| Exact Mass | 768.46 |
| IUPAC Name | 25,26,27,28-tetrapentylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol |
| SMILES | CCCCCc1c2c(O)cc(O)c1Cc1c(O)cc(O)c(c1CCCCC)Cc1c(O)cc(O)c(c1CCCCC)Cc1c(O)cc(O)c(c1CCCCC)C2 |
| InChI | InChI=1S/C48H64O8/c1-5-9-13-17-29-33-21-35-30(18-14-10-6-2)37(45(53)26-43(35)51)23-39-32(20-16-12-8-4)40(48(56)28-47(39)55)24-38-31(19-15-11-7-3)36(44(52)27-46(38)54)22-34(29)42(50)25-41(33)49/h25-28,49-56H,5-24H2,1-4H3 |
| InChIKey | LDNLKGPRNMIUDK-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.03 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|