C17H27ClO3 — CID 174497632
4-chloro-5-methyl-2-nonylbenzene-1,3-diol;formaldehyde (PubChem CID 174497632) has the molecular formula C17H27ClO3 and a molecular weight of 314.85 g/mol. Its IUPAC name is 4-chloro-5-methyl-2-nonylbenzene-1,3-diol;formaldehyde.
| Compound Name | 4-chloro-5-methyl-2-nonylbenzene-1,3-diol;formaldehyde |
|---|---|
| PubChem CID | 174497632 |
| Molecular Formula | C17H27ClO3 |
| Molecular Weight | 314.85 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-chloro-5-methyl-2-nonylbenzene-1,3-diol;formaldehyde |
| SMILES | C=O.CCCCCCCCCc1c(O)cc(C)c(Cl)c1O |
| InChI | InChI=1S/C16H25ClO2.CH2O/c1-3-4-5-6-7-8-9-10-13-14(18)11-12(2)15(17)16(13)19;1-2/h11,18-19H,3-10H2,1-2H3;1H2 |
| InChIKey | YCJLVHKHNDWUIQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.85 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|