C15H24O — CID 139832207
2-butyl-3-ethyl-4,5,6-trimethylphenol (PubChem CID 139832207) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-butyl-3-ethyl-4,5,6-trimethylphenol.
| Compound Name | 2-butyl-3-ethyl-4,5,6-trimethylphenol |
|---|---|
| PubChem CID | 139832207 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-butyl-3-ethyl-4,5,6-trimethylphenol |
| SMILES | CCCCc1c(O)c(C)c(C)c(C)c1CC |
| InChI | InChI=1S/C15H24O/c1-6-8-9-14-13(7-2)11(4)10(3)12(5)15(14)16/h16H,6-9H2,1-5H3 |
| InChIKey | NDOMRACSXJUMGP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |