C18H32N2 — CID 58250570
4,5-dihexyl-3,6-dimethylpyridazine (PubChem CID 58250570) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 4,5-dihexyl-3,6-dimethylpyridazine.
| Compound Name | 4,5-dihexyl-3,6-dimethylpyridazine |
|---|---|
| PubChem CID | 58250570 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 4,5-dihexyl-3,6-dimethylpyridazine |
| SMILES | CCCCCCc1c(C)nnc(C)c1CCCCCC |
| InChI | InChI=1S/C18H32N2/c1-5-7-9-11-13-17-15(3)19-20-16(4)18(17)14-12-10-8-6-2/h5-14H2,1-4H3 |
| InChIKey | LQVVANKSPHGDIO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|