C12H23N4+ — CID 5260123
5-heptyl-6-methylpyrimidin-3-ium-2,4-diamine (PubChem CID 5260123) has the molecular formula C12H23N4+ and a molecular weight of 223.34 g/mol. Its IUPAC name is 5-heptyl-6-methylpyrimidin-3-ium-2,4-diamine.
| Compound Name | 5-heptyl-6-methylpyrimidin-3-ium-2,4-diamine |
|---|---|
| PubChem CID | 5260123 |
| Molecular Formula | C12H23N4+ |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 5-heptyl-6-methylpyrimidin-3-ium-2,4-diamine |
| SMILES | CCCCCCCc1c(C)nc(N)[nH+]c1N |
| InChI | InChI=1S/C12H22N4/c1-3-4-5-6-7-8-10-9(2)15-12(14)16-11(10)13/h3-8H2,1-2H3,(H4,13,14,15,16)/p+1 |
| InChIKey | LCYHNZFYRQBXFR-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 79.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|