C8H15N3S — CID 114754147
5-hexyl-1,2,4-thiadiazol-3-amine (PubChem CID 114754147) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is 5-hexyl-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-hexyl-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 114754147 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 5-hexyl-1,2,4-thiadiazol-3-amine |
| SMILES | CCCCCCc1nc(N)ns1 |
| InChI | InChI=1S/C8H15N3S/c1-2-3-4-5-6-7-10-8(9)11-12-7/h2-6H2,1H3,(H2,9,11) |
| InChIKey | ZTYIVEXFWWJFQO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|