C16H24Br2O2 — CID 71394054
4,6-dibromo-2-methyl-5-nonylbenzene-1,3-diol (PubChem CID 71394054) has the molecular formula C16H24Br2O2 and a molecular weight of 408.17 g/mol. Its IUPAC name is 4,6-dibromo-2-methyl-5-nonylbenzene-1,3-diol.
| Compound Name | 4,6-dibromo-2-methyl-5-nonylbenzene-1,3-diol |
|---|---|
| PubChem CID | 71394054 |
| Molecular Formula | C16H24Br2O2 |
| Molecular Weight | 408.17 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 4,6-dibromo-2-methyl-5-nonylbenzene-1,3-diol |
| SMILES | CCCCCCCCCc1c(Br)c(O)c(C)c(O)c1Br |
| InChI | InChI=1S/C16H24Br2O2/c1-3-4-5-6-7-8-9-10-12-13(17)15(19)11(2)16(20)14(12)18/h19-20H,3-10H2,1-2H3 |
| InChIKey | UDUVTULXWOOMEO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.17 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|