C14H17Br3O3 — CID 11626991
methyl 2,3,4-tribromo-6-hexyl-5-hydroxybenzoate (PubChem CID 11626991) has the molecular formula C14H17Br3O3 and a molecular weight of 473.00 g/mol. Its IUPAC name is methyl 2,3,4-tribromo-6-hexyl-5-hydroxybenzoate.
| Compound Name | methyl 2,3,4-tribromo-6-hexyl-5-hydroxybenzoate |
|---|---|
| PubChem CID | 11626991 |
| Molecular Formula | C14H17Br3O3 |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 469.87 |
| IUPAC Name | methyl 2,3,4-tribromo-6-hexyl-5-hydroxybenzoate |
| SMILES | CCCCCCc1c(O)c(Br)c(Br)c(Br)c1C(=O)OC |
| InChI | InChI=1S/C14H17Br3O3/c1-3-4-5-6-7-8-9(14(19)20-2)10(15)11(16)12(17)13(8)18/h18H,3-7H2,1-2H3 |
| InChIKey | JDCJRNOQKPTXRX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|