C24H38O4 — CID 86229285
dimethyl 6-octyl-3,4-dipropylbenzene-1,2-dicarboxylate (PubChem CID 86229285) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is dimethyl 6-octyl-3,4-dipropylbenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 6-octyl-3,4-dipropylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 86229285 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | dimethyl 6-octyl-3,4-dipropylbenzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCc1cc(CCC)c(CCC)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C24H38O4/c1-6-9-10-11-12-13-16-19-17-18(14-7-2)20(15-8-3)22(24(26)28-5)21(19)23(25)27-4/h17H,6-16H2,1-5H3 |
| InChIKey | BQVRCLFXPOLRJA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|