C20H30O5 — CID 10948102
methyl 5-formyl-3-hexyl-2,4-dimethoxy-6-propylbenzoate (PubChem CID 10948102) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 5-formyl-3-hexyl-2,4-dimethoxy-6-propylbenzoate.
| Compound Name | methyl 5-formyl-3-hexyl-2,4-dimethoxy-6-propylbenzoate |
|---|---|
| PubChem CID | 10948102 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | methyl 5-formyl-3-hexyl-2,4-dimethoxy-6-propylbenzoate |
| SMILES | CCCCCCc1c(OC)c(C=O)c(CCC)c(C(=O)OC)c1OC |
| InChI | InChI=1S/C20H30O5/c1-6-8-9-10-12-15-18(23-3)16(13-21)14(11-7-2)17(19(15)24-4)20(22)25-5/h13H,6-12H2,1-5H3 |
| InChIKey | IAHZARRHZYRRFI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|