C48H58O8 — CID 59444892
tetramethyl 1,4,8,11-tetrabutyl-6,13-dimethylpentacene-2,3,9,10-tetracarboxylate (PubChem CID 59444892) has the molecular formula C48H58O8 and a molecular weight of 762.98 g/mol. Its IUPAC name is tetramethyl 1,4,8,11-tetrabutyl-6,13-dimethylpentacene-2,3,9,10-tetracarboxylate.
| Compound Name | tetramethyl 1,4,8,11-tetrabutyl-6,13-dimethylpentacene-2,3,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 59444892 |
| Molecular Formula | C48H58O8 |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.41 |
| IUPAC Name | tetramethyl 1,4,8,11-tetrabutyl-6,13-dimethylpentacene-2,3,9,10-tetracarboxylate |
| SMILES | CCCCc1c(C(=O)OC)c(C(=O)OC)c(CCCC)c2cc3c(C)c4cc5c(CCCC)c(C(=O)OC)c(C(=O)OC)c(CCCC)c5cc4c(C)c3cc12 |
| InChI | InChI=1S/C48H58O8/c1-11-15-19-29-37-23-33-27(5)35-25-39-31(21-17-13-3)43(47(51)55-9)44(48(52)56-10)32(22-18-14-4)40(39)26-36(35)28(6)34(33)24-38(37)30(20-16-12-2)42(46(50)54-8)41(29)45(49)53-7/h23-26H,11-22H2,1-10H3 |
| InChIKey | NOWNKRKZENPZGB-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|