C38H54O4 — CID 101152709
dimethyl 1,4,6,11-tetrabutyl-5,7,8,9,10,12-hexahydrotetracene-2,3-dicarboxylate (PubChem CID 101152709) has the molecular formula C38H54O4 and a molecular weight of 574.85 g/mol. Its IUPAC name is dimethyl 1,4,6,11-tetrabutyl-5,7,8,9,10,12-hexahydrotetracene-2,3-dicarboxylate.
| Compound Name | dimethyl 1,4,6,11-tetrabutyl-5,7,8,9,10,12-hexahydrotetracene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101152709 |
| Molecular Formula | C38H54O4 |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 574.40 |
| IUPAC Name | dimethyl 1,4,6,11-tetrabutyl-5,7,8,9,10,12-hexahydrotetracene-2,3-dicarboxylate |
| SMILES | CCCCc1c2c(c(CCCC)c3c1Cc1c(c(CCCC)c(C(=O)OC)c(C(=O)OC)c1CCCC)C3)CCCC2 |
| InChI | InChI=1S/C38H54O4/c1-7-11-17-27-25-21-15-16-22-26(25)28(18-12-8-2)32-24-34-30(20-14-10-4)36(38(40)42-6)35(37(39)41-5)29(19-13-9-3)33(34)23-31(27)32/h7-24H2,1-6H3 |
| InChIKey | VZGROVKAYSPWBG-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |