C48H62O8 — CID 89234267
dimethyl 1,4,8,11-tetrabutyl-6,13-dimethyl-9,10-bis(methylperoxymethyl)pentacene-2,3-dicarboxylate (PubChem CID 89234267) has the molecular formula C48H62O8 and a molecular weight of 767.02 g/mol. Its IUPAC name is dimethyl 1,4,8,11-tetrabutyl-6,13-dimethyl-9,10-bis(methylperoxymethyl)pentacene-2,3-dicarboxylate.
| Compound Name | dimethyl 1,4,8,11-tetrabutyl-6,13-dimethyl-9,10-bis(methylperoxymethyl)pentacene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 89234267 |
| Molecular Formula | C48H62O8 |
| Molecular Weight | 767.02 g/mol |
| Exact Mass | 766.44 |
| IUPAC Name | dimethyl 1,4,8,11-tetrabutyl-6,13-dimethyl-9,10-bis(methylperoxymethyl)pentacene-2,3-dicarboxylate |
| SMILES | CCCCc1c(COOC)c(COOC)c(CCCC)c2cc3c(C)c4cc5c(CCCC)c(C(=O)OC)c(C(=O)OC)c(CCCC)c5cc4c(C)c3cc12 |
| InChI | InChI=1S/C48H62O8/c1-11-15-19-31-39-23-35-29(5)37-25-41-33(21-17-13-3)45(47(49)51-7)46(48(50)52-8)34(22-18-14-4)42(41)26-38(37)30(6)36(35)24-40(39)32(20-16-12-2)44(28-56-54-10)43(31)27-55-53-9/h23-26H,11-22,27-28H2,1-10H3 |
| InChIKey | BXYOFTYTDBCJJQ-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.02 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|