C68H96O8Si2 — CID 101462889
tetramethyl 1,4,8,11-tetrabutyl-6,13-bis[2-tri(propan-2-yl)silylethynyl]pentacene-1,4,9,10-tetracarboxylate (PubChem CID 101462889) has the molecular formula C68H96O8Si2 and a molecular weight of 1097.68 g/mol. Its IUPAC name is tetramethyl 1,4,8,11-tetrabutyl-6,13-bis[2-tri(propan-2-yl)silylethynyl]pentacene-1,4,9,10-tetracarboxylate.
| Compound Name | tetramethyl 1,4,8,11-tetrabutyl-6,13-bis[2-tri(propan-2-yl)silylethynyl]pentacene-1,4,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 101462889 |
| Molecular Formula | C68H96O8Si2 |
| Molecular Weight | 1097.68 g/mol |
| Exact Mass | 1096.66 |
| IUPAC Name | tetramethyl 1,4,8,11-tetrabutyl-6,13-bis[2-tri(propan-2-yl)silylethynyl]pentacene-1,4,9,10-tetracarboxylate |
| SMILES | CCCCc1c(C(=O)OC)c(C(=O)OC)c(CCCC)c2cc3c(C#C[Si](C(C)C)(C(C)C)C(C)C)c4cc5c(cc4c(C#C[Si](C(C)C)(C(C)C)C(C)C)c3cc12)C(CCCC)(C(=O)OC)C=CC5(CCCC)C(=O)OC |
| InChI | InChI=1S/C68H96O8Si2/c1-21-25-29-51-55-39-53-49(31-37-77(43(5)6,44(7)8)45(9)10)57-41-59-60(68(34-28-24-4,66(72)76-20)36-35-67(59,33-27-23-3)65(71)75-19)42-58(57)50(32-38-78(46(11)12,47(13)14)48(15)16)54(53)40-56(55)52(30-26-22-2)62(64(70)74-18)61(51)63(69)73-17/h35-36,39-48H,21-30,33-34H2,1-20H3 |
| InChIKey | WMGZWOWZMXWRCU-UHFFFAOYSA-N |
| XLogP | 17.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.68 |
| LogP ≤ 5 | 17.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|