C14H19NO4 — CID 44521370
dimethyl 4-butyl-6-methylpyridine-2,3-dicarboxylate (PubChem CID 44521370) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is dimethyl 4-butyl-6-methylpyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 4-butyl-6-methylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 44521370 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | dimethyl 4-butyl-6-methylpyridine-2,3-dicarboxylate |
| SMILES | CCCCc1cc(C)nc(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C14H19NO4/c1-5-6-7-10-8-9(2)15-12(14(17)19-4)11(10)13(16)18-3/h8H,5-7H2,1-4H3 |
| InChIKey | FJLIGXWPGMMXGK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |