C36H46O4 — CID 139940268
dimethyl 1,4-dibutyl-6,11-dipropyl-5,12-dihydrotetracene-2,3-dicarboxylate (PubChem CID 139940268) has the molecular formula C36H46O4 and a molecular weight of 542.76 g/mol. Its IUPAC name is dimethyl 1,4-dibutyl-6,11-dipropyl-5,12-dihydrotetracene-2,3-dicarboxylate.
| Compound Name | dimethyl 1,4-dibutyl-6,11-dipropyl-5,12-dihydrotetracene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139940268 |
| Molecular Formula | C36H46O4 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | dimethyl 1,4-dibutyl-6,11-dipropyl-5,12-dihydrotetracene-2,3-dicarboxylate |
| SMILES | CCCCc1c2c(c(CCCC)c(C(=O)OC)c1C(=O)OC)Cc1c(c(CCC)c3ccccc3c1CCC)C2 |
| InChI | InChI=1S/C36H46O4/c1-7-11-17-27-31-21-29-23(15-9-3)25-19-13-14-20-26(25)24(16-10-4)30(29)22-32(31)28(18-12-8-2)34(36(38)40-6)33(27)35(37)39-5/h13-14,19-20H,7-12,15-18,21-22H2,1-6H3 |
| InChIKey | XBAMELVDOZTJIB-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |