C25H42O6 — CID 87860049
2-hydroxy-4-methoxy-3-methylperoxy-5,6-dioctylbenzoic acid (PubChem CID 87860049) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-3-methylperoxy-5,6-dioctylbenzoic acid.
| Compound Name | 2-hydroxy-4-methoxy-3-methylperoxy-5,6-dioctylbenzoic acid |
|---|---|
| PubChem CID | 87860049 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 2-hydroxy-4-methoxy-3-methylperoxy-5,6-dioctylbenzoic acid |
| SMILES | CCCCCCCCc1c(CCCCCCCC)c(C(=O)O)c(O)c(OOC)c1OC |
| InChI | InChI=1S/C25H42O6/c1-5-7-9-11-13-15-17-19-20(18-16-14-12-10-8-6-2)23(29-3)24(31-30-4)22(26)21(19)25(27)28/h26H,5-18H2,1-4H3,(H,27,28) |
| InChIKey | HSLKKLKNHJWQAE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|