C26H44O5 — CID 87860100
2,3,4-tributyl-5-heptylperoxy-6-hydroxybenzoic acid (PubChem CID 87860100) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is 2,3,4-tributyl-5-heptylperoxy-6-hydroxybenzoic acid.
| Compound Name | 2,3,4-tributyl-5-heptylperoxy-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 87860100 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 2,3,4-tributyl-5-heptylperoxy-6-hydroxybenzoic acid |
| SMILES | CCCCCCCOOc1c(O)c(C(=O)O)c(CCCC)c(CCCC)c1CCCC |
| InChI | InChI=1S/C26H44O5/c1-5-9-13-14-15-19-30-31-25-22(18-12-8-4)20(16-10-6-2)21(17-11-7-3)23(24(25)27)26(28)29/h27H,5-19H2,1-4H3,(H,28,29) |
| InChIKey | KLCBCFOWTFFPNS-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|