C30H52O5 — CID 87860179
5-ethylperoxy-2,3,4-triheptyl-6-hydroxybenzoic acid (PubChem CID 87860179) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is 5-ethylperoxy-2,3,4-triheptyl-6-hydroxybenzoic acid.
| Compound Name | 5-ethylperoxy-2,3,4-triheptyl-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 87860179 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | 5-ethylperoxy-2,3,4-triheptyl-6-hydroxybenzoic acid |
| SMILES | CCCCCCCc1c(CCCCCCC)c(OOCC)c(O)c(C(=O)O)c1CCCCCCC |
| InChI | InChI=1S/C30H52O5/c1-5-9-12-15-18-21-24-25(22-19-16-13-10-6-2)27(30(32)33)28(31)29(35-34-8-4)26(24)23-20-17-14-11-7-3/h31H,5-23H2,1-4H3,(H,32,33) |
| InChIKey | WYOKGXOZQPRLJS-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|