C34H60O6 — CID 87859692
3,4-didecoxy-2-heptyl-5,6-dihydroxybenzoic acid (PubChem CID 87859692) has the molecular formula C34H60O6 and a molecular weight of 564.85 g/mol. Its IUPAC name is 3,4-didecoxy-2-heptyl-5,6-dihydroxybenzoic acid.
| Compound Name | 3,4-didecoxy-2-heptyl-5,6-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 87859692 |
| Molecular Formula | C34H60O6 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.44 |
| IUPAC Name | 3,4-didecoxy-2-heptyl-5,6-dihydroxybenzoic acid |
| SMILES | CCCCCCCCCCOc1c(O)c(O)c(C(=O)O)c(CCCCCCC)c1OCCCCCCCCCC |
| InChI | InChI=1S/C34H60O6/c1-4-7-10-13-15-17-20-23-26-39-32-28(25-22-19-12-9-6-3)29(34(37)38)30(35)31(36)33(32)40-27-24-21-18-16-14-11-8-5-2/h35-36H,4-27H2,1-3H3,(H,37,38) |
| InChIKey | SAMRMQKJXYSYOK-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|