C15H20Cl2O4 — CID 87859403
4,5-dichloro-2,3-dihydroxy-6-octylbenzoic acid (PubChem CID 87859403) has the molecular formula C15H20Cl2O4 and a molecular weight of 335.23 g/mol. Its IUPAC name is 4,5-dichloro-2,3-dihydroxy-6-octylbenzoic acid.
| Compound Name | 4,5-dichloro-2,3-dihydroxy-6-octylbenzoic acid |
|---|---|
| PubChem CID | 87859403 |
| Molecular Formula | C15H20Cl2O4 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4,5-dichloro-2,3-dihydroxy-6-octylbenzoic acid |
| SMILES | CCCCCCCCc1c(Cl)c(Cl)c(O)c(O)c1C(=O)O |
| InChI | InChI=1S/C15H20Cl2O4/c1-2-3-4-5-6-7-8-9-10(15(20)21)13(18)14(19)12(17)11(9)16/h18-19H,2-8H2,1H3,(H,20,21) |
| InChIKey | SHFRLUKUSWLXMV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|