C23H36Cl2O4 — CID 87859573
chloro 4-chloro-2,3-dihydroxy-5,6-dioctylbenzoate (PubChem CID 87859573) has the molecular formula C23H36Cl2O4 and a molecular weight of 447.44 g/mol. Its IUPAC name is chloro 4-chloro-2,3-dihydroxy-5,6-dioctylbenzoate.
| Compound Name | chloro 4-chloro-2,3-dihydroxy-5,6-dioctylbenzoate |
|---|---|
| PubChem CID | 87859573 |
| Molecular Formula | C23H36Cl2O4 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | chloro 4-chloro-2,3-dihydroxy-5,6-dioctylbenzoate |
| SMILES | CCCCCCCCc1c(Cl)c(O)c(O)c(C(=O)OCl)c1CCCCCCCC |
| InChI | InChI=1S/C23H36Cl2O4/c1-3-5-7-9-11-13-15-17-18(16-14-12-10-8-6-4-2)20(24)22(27)21(26)19(17)23(28)29-25/h26-27H,3-16H2,1-2H3 |
| InChIKey | OARQOPYXFXUDNM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|