C11H12I2O4 — CID 87859857
2-butyl-5,6-dihydroxy-3,4-diiodobenzoic acid (PubChem CID 87859857) has the molecular formula C11H12I2O4 and a molecular weight of 462.02 g/mol. Its IUPAC name is 2-butyl-5,6-dihydroxy-3,4-diiodobenzoic acid.
| Compound Name | 2-butyl-5,6-dihydroxy-3,4-diiodobenzoic acid |
|---|---|
| PubChem CID | 87859857 |
| Molecular Formula | C11H12I2O4 |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.88 |
| IUPAC Name | 2-butyl-5,6-dihydroxy-3,4-diiodobenzoic acid |
| SMILES | CCCCc1c(I)c(I)c(O)c(O)c1C(=O)O |
| InChI | InChI=1S/C11H12I2O4/c1-2-3-4-5-6(11(16)17)9(14)10(15)8(13)7(5)12/h14-15H,2-4H2,1H3,(H,16,17) |
| InChIKey | SFUXUSDCBSKDLE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|