C21H32O5 — CID 46894610
1-O-ethyl 2-O-methyl 3-hydroxy-5-methyl-4-nonylbenzene-1,2-dicarboxylate (PubChem CID 46894610) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 1-O-ethyl 2-O-methyl 3-hydroxy-5-methyl-4-nonylbenzene-1,2-dicarboxylate.
| Compound Name | 1-O-ethyl 2-O-methyl 3-hydroxy-5-methyl-4-nonylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 46894610 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-O-ethyl 2-O-methyl 3-hydroxy-5-methyl-4-nonylbenzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCc1c(C)cc(C(=O)OCC)c(C(=O)OC)c1O |
| InChI | InChI=1S/C21H32O5/c1-5-7-8-9-10-11-12-13-16-15(3)14-17(20(23)26-6-2)18(19(16)22)21(24)25-4/h14,22H,5-13H2,1-4H3 |
| InChIKey | AWEQBKOLOKHNAC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|