dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate

C22H34O4 — CID 86229279

IUPACdimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate
SMILESCCCCCCCCc1cc(C(=O)OC)c(C(=O)OC)c(CC)c1CC
InChIInChI=1S/C22H34O4/c1-6-9-10-11-12-13-14-16-15-19(21(23)25-4)20(22(24)26-5)18(8-3)17(16)7-2/h15H,6-14H2,1-5H3
InChIKeyHLKSXQRHUFGYER-UHFFFAOYSA-N
MW362.51 g/mol
LogP5.29
Rot. Bonds11

About dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate

dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate (PubChem CID 86229279) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate.

Molecular Properties

Compound Namedimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate
PubChem CID86229279
Molecular FormulaC22H34O4
Molecular Weight362.51 g/mol
Exact Mass362.25
IUPAC Namedimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate
SMILESCCCCCCCCc1cc(C(=O)OC)c(C(=O)OC)c(CC)c1CC
InChIInChI=1S/C22H34O4/c1-6-9-10-11-12-13-14-16-15-19(21(23)25-4)20(22(24)26-5)18(8-3)17(16)7-2/h15H,6-14H2,1-5H3
InChIKeyHLKSXQRHUFGYER-UHFFFAOYSA-N
XLogP5.29
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds11
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500362.51
LogP ≤ 55.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate?
The IUPAC name of dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate (CID 86229279) is dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate?
The canonical SMILES for dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate is CCCCCCCCc1cc(C(=O)OC)c(C(=O)OC)c(CC)c1CC.
What is the InChIKey of dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate?
The InChIKey is HLKSXQRHUFGYER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O4/c1-6-9-10-11-12-13-14-16-15-19(21(23)25-4)20(22(24)26-5)18(8-3)17(16)7-2/h15H,6-14H2,1-5H3.
What are the key properties of dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate?
dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate has a molecular weight of 362.51 g/mol, XLogP of 5.29, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3,4-diethyl-5-octylbenzene-1,2-dicarboxylate is sourced from PubChem (CID 86229279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).