C16H26 — CID 143192924
(1E,3Z,5Z)-2-hexyl-4,7-dimethylcycloocta-1,3,5-triene (PubChem CID 143192924) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (1E,3Z,5Z)-2-hexyl-4,7-dimethylcycloocta-1,3,5-triene.
| Compound Name | (1E,3Z,5Z)-2-hexyl-4,7-dimethylcycloocta-1,3,5-triene |
|---|---|
| PubChem CID | 143192924 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (1E,3Z,5Z)-2-hexyl-4,7-dimethylcycloocta-1,3,5-triene |
| SMILES | CCCCCCC1=C/CC(C)/C=C/C(C)=C\1 |
| InChI | InChI=1S/C16H26/c1-4-5-6-7-8-16-12-11-14(2)9-10-15(3)13-16/h9-10,12-14H,4-8,11H2,1-3H3/b10-9-,15-13-,16-12- |
| InChIKey | NDLAEMPUUJSQJB-UKASGLFGSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|