C17H28 — CID 139627561
2-(4-butylcyclohexyl)-5-methylcyclohexa-1,3-diene (PubChem CID 139627561) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 2-(4-butylcyclohexyl)-5-methylcyclohexa-1,3-diene.
| Compound Name | 2-(4-butylcyclohexyl)-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139627561 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 2-(4-butylcyclohexyl)-5-methylcyclohexa-1,3-diene |
| SMILES | CCCCC1CCC(C2=CCC(C)C=C2)CC1 |
| InChI | InChI=1S/C17H28/c1-3-4-5-15-8-12-17(13-9-15)16-10-6-14(2)7-11-16/h6,10-11,14-15,17H,3-5,7-9,12-13H2,1-2H3 |
| InChIKey | AYDAPVAFLLUADK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |