C23H34 — CID 20538128
1-(4-butylcyclohexyl)-4-(4-methylcyclohexen-1-yl)benzene (PubChem CID 20538128) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-(4-butylcyclohexyl)-4-(4-methylcyclohexen-1-yl)benzene.
| Compound Name | 1-(4-butylcyclohexyl)-4-(4-methylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 20538128 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 1-(4-butylcyclohexyl)-4-(4-methylcyclohexen-1-yl)benzene |
| SMILES | CCCCC1CCC(c2ccc(C3=CCC(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C23H34/c1-3-4-5-19-8-12-21(13-9-19)23-16-14-22(15-17-23)20-10-6-18(2)7-11-20/h10,14-19,21H,3-9,11-13H2,1-2H3 |
| InChIKey | DXPGFKJRHLRASZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |