C11H19BO2 — CID 134064083
(4-pentylcyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 134064083) has the molecular formula C11H19BO2 and a molecular weight of 194.08 g/mol. Its IUPAC name is (4-pentylcyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (4-pentylcyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 134064083 |
| Molecular Formula | C11H19BO2 |
| Molecular Weight | 194.08 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (4-pentylcyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | CCCCCC1=CCC(B(O)O)C=C1 |
| InChI | InChI=1S/C11H19BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-8,11,13-14H,2-5,9H2,1H3 |
| InChIKey | ALKZWKFFJZCAHW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.08 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|